YRC Logo
PROTEIN SEARCH:
Descriptions Names[Advanced Search]

Catalysis of the reaction: 3-guanidinopropanoate + H2O = beta-alanine + urea. Catalysis of the reaction: amidinoproclavaminate + H2O = proclavaminate + urea. Catalysis of the reaction: 4-guanidinobutanoate + H2O = 4-aminobutanoate + urea. Catalysis of the reaction: guanidinoacetate + H2O = glycine + urea. Catalysis of the reaction: (-)-ureidoglycolate + H2O = glyoxylate + 2 NH3 + CO2. Catalysis of the hydrolysis of any carbon-nitrogen bond, C-N, with the exception of peptide bonds. Catalysis of the reaction: agmatine + H2O = putrescine + urea. Catalysis of the hydrolysis of any non-peptide carbon-nitrogen bond in a linear amidine, a compound of the form R-C(=NH)-NH2. Catalysis of the reaction: agmatine + H2O = N-carbamoylputrescine + NH3. Catalysis of the reaction: L-arginine + H2O = L-citrulline + NH3. 2-chloro-4-hydroxy-6-amino-1,3,5-triazine + OH- = 2,4-dihydroxy-6-amino-1,3,5-triazine + Cl-. Catalysis of the reaction: ammeline + H2O = ammelide + NH3. Catalysis of the reaction: ammelide + H2O = cyanuric acid + NH3. Catalysis of the reaction: methylguanidine + H2O = methylamine + urea. Catalysis of the reaction: N-amidino-L-aspartate + H2O = L-aspartate + urea. Catalysis of the reaction: N-formimidoyl-L-aspartate + H2O = N-formyl-L-aspartate + NH3. Catalysis of the reaction: N-formimidoyl-L-glutamate + H2O = L-glutamate + formamide. Catalysis of the reaction: N1-aminopropylagmatine + H2O = spermidine + urea. Catalysis of the reaction: D-arginine + H2O = D-ornithine + urea. Catalysis of the reaction: N-formimidoyl-L-glutamate + H2O = N-formyl-L-glutamate + NH3. Catalysis of the reaction: 1,4-diguanidinobutane + H2O = agmatine + urea. Catalysis of the reaction: creatine + H2O = sarcosine + urea. Catalysis of the reaction: protein L-arginine + H2O = protein L-citrulline + NH3. Catalysis of the reaction: 5-ureido-4-imidazole carboxylate + H2O = 5-amino-4-imidazole carboxylate + NH3 + CO2. Catalysis of the reaction: N2-succinyl-L-arginine + 2 H2O = N2-succinyl-L-ornithine + 2 NH3 + CO. Catalysis of the reaction: allantoate + H2O + H+ = CO2 + NH3 + ureidoglycine. Catalysis of the reaction: deisopropylhydroxyatrazine + H2O = NH3 + 2,4-dihydroxy-6-(N'-ethyl)amino-1,3,5-triazine. Catalysis of the reaction: 2 H2O + NH(2)-CO-NH-CH(2)-NH-CO-NH(2) = CO2 + 2 NH3 + N-hydroxymethylurea. Catalysis of the reaction: 2,4-dihydroxy-6-(N'-ethyl)amino-1,3,5-triazine + H2O = CH3CH2NH2 + cyanuric acid. Catalysis of the hydrolysis of various bonds, e.g. C-O, C-N, C-C, phosphoric anhydride bonds, etc. Hydrolase is the systematic name for any enzyme of EC class 3. Catalysis of the reaction: allantoate + H2O = (-)-ureidoglycolate + urea. Catalysis of the reaction: ureidoglycine + H2O = S-ureidoglycolate + NH3. Catalysis of the reaction: L-arginine + H2O = L-ornithine + urea. Catalysis of the reaction: N(G),N(G)-dimethyl-L-arginine + H2O = dimethylamine + L-citrulline.

View Gene Ontology (GO) Term

GO TERM SUMMARY

Name: hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines
Acc: GO:0016813
Aspect: Molecular Function
Desc: Catalysis of the hydrolysis of any non-peptide carbon-nitrogen bond in a linear amidine, a compound of the form R-C(=NH)-NH2.
Proteins in PDR annotated with:
   This term: 22 [Search]
   Term or descendants: 88 [Search]


[geneontology.org]
INTERACTIVE GO GRAPH

GO:0016813 - hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines (interactive image map)

YRC Informatics Platform - Version 3.0
Created and Maintained by: Michael Riffle