YRC Logo
PROTEIN SEARCH:
Descriptions Names[Advanced Search]

Catalysis of the reaction: 1-aminocyclopropane-1-carboxylate + H2O = 2-oxobutanoate + NH3. Catalysis of the reaction: creatinine + H2O = N-methylhydantoin + NH3. Catalysis of the reaction: dCTP + 2 H2O = dUMP + diphosphate + NH3. Catalysis of the reaction: adenine + H2O = hypoxanthine + NH3. Catalysis of the reaction: deoxycytidine + H2O = deoxyuridine + NH3. Catalysis of the reaction: 2-aminomuconate + H2O = 4-oxalocrotonate + NH3. Catalysis of the reaction: 2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + H2O = 5-amino-6-(5-phosphoribosylamino)uracil + NH3. Catalysis of a biochemical reaction at physiological temperatures. In biologically catalyzed reactions, the reactants are known as substrates, and the catalysts are naturally occurring macromolecular substances known as enzymes. Enzymes possess specific binding sites for substrates, and are usually composed wholly or largely of protein, but RNA that has catalytic activity (ribozyme) is often also regarded as enzymatic. Elemental activities, such as catalysis or binding, describing the actions of a gene product at the molecular level. A given gene product may exhibit one or more molecular functions. Catalysis of the reaction: adenosine + H2O = inosine + NH3. Catalysis of the reaction: S-adenosyl-L-homocysteine + H2O = S-inosyl-L-homocysteine + NH3. Catalysis of the reaction: cytidine + H2O = uridine + NH3. Catalysis of the reaction: 2-amino-4-hydroxypteridine + H2O = 2,4-dihydroxypteridine + NH3. Catalysis of the reaction: 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate = 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate. Catalysis of the reaction: AMP + H2O = IMP + NH3. Catalysis of the reaction: sepiapterin + H2O = xanthopterin-B2 + NH3. Catalysis of the reaction: 5-formimidoyltetrahydrofolate = 5,10-methenyltetrahydrofolate + NH3. Catalysis of the reaction: ADP + H2O = IDP + NH3. Catalysis of the reaction: L-ornithine = L-proline + NH3. Catalysis of the reaction: 1-(4-amino-2-methylpyrimid-5-ylmethyl)-3-(beta-hydroxyethyl)-2-methylpyridinium bromide + H2O = 1-(4-hydroxy-2-methylpyrimid-5-ylmethyl)-3-(beta-hydroxyethyl)-2-methylpyridinium bromide + NH3. Catalysis of the removal of an amino group from a substrate, producing ammonia (NH3). Catalysis of the reaction: 5'-AMP + H2O = 5'-IMP + NH3. Catalysis of the reaction: blasticidin S + H2O = deaminohydroxyblasticidin S + NH3. Catalysis of the reaction: H2O + 1-pyrroline-4-hydroxy-2-carboxylate = NH3 + 2,5-dioxopentanoate. Catalysis of the reaction: 2 H2O + NH(2)-CO-NH-CH(2)-NH-CO-NH(2) = CO2 + 2 NH3 + N-hydroxymethylurea. Catalysis of the reaction: dCTP + H2O = dUTP + NH3. Catalysis of the reaction: D-glucosamine 6-phosphate + H2O = D-fructose 6-phosphate + NH3. Catalysis of the reaction: guanine + H2O = xanthine + NH3. Catalysis of the reaction: 7,8-dihydropterin + H20 = 7,8-dihydrolumazine + NH3. Catalysis of the reaction: deoxyadenosine + H2O = deoxyinosine + NH3. Catalysis of the reaction: ATP + H2O = ITP + NH3. Catalysis of the reaction: guanosine + H2O = xanthosine + NH3. Catalysis of the reaction: cytosine + H2O = uracil + NH3. Catalysis of the reaction: dCMP + H2O = dUMP + NH3.

View Gene Ontology (GO) Term

GO TERM SUMMARY

Name: deaminase activity
Acc: GO:0019239
Aspect: Molecular Function
Desc: Catalysis of the removal of an amino group from a substrate, producing ammonia (NH3).
Proteins in PDR annotated with:
   This term: 28 [Search]
   Term or descendants: 208 [Search]


[geneontology.org]
INTERACTIVE GO GRAPH

GO:0019239 - deaminase activity (interactive image map)

YRC Informatics Platform - Version 3.0
Created and Maintained by: Michael Riffle